C28H34F2N10O11P+ — CID 174232702
bis[[(4S,5R)-4-fluoro-5-(hydroxymethyl)-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxy]-oxophosphanium (PubChem CID 174232702) has the molecular formula C28H34F2N10O11P+ and a molecular weight of 755.61 g/mol. Its IUPAC name is bis[[(4S,5R)-4-fluoro-5-(hydroxymethyl)-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxy]-oxophosphanium.
| Compound Name | bis[[(4S,5R)-4-fluoro-5-(hydroxymethyl)-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxy]-oxophosphanium |
|---|---|
| PubChem CID | 174232702 |
| Molecular Formula | C28H34F2N10O11P+ |
| Molecular Weight | 755.61 g/mol |
| Exact Mass | 755.21 |
| IUPAC Name | bis[[(4S,5R)-4-fluoro-5-(hydroxymethyl)-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxy]-oxophosphanium |
| SMILES | CC(C)C(=O)Nc1nc2c(ncn2C2O[C@H](CO)[C@H](F)C2O[P+](=O)OC2C(n3cnc4c(=O)[nH]c(NC(=O)C(C)C)nc43)O[C@H](CO)[C@@H]2F)c(=O)[nH]1 |
| InChI | InChI=1S/C28H33F2N10O11P/c1-9(2)21(43)35-27-33-19-15(23(45)37-27)31-7-39(19)25-17(13(29)11(5-41)48-25)50-52(47)51-18-14(30)12(6-42)49-26(18)40-8-32-16-20(40)34-28(38-24(16)46)36-22(44)10(3)4/h7-14,17-18,25-26,41-42H,5-6H2,1-4H3,(H3-,33,34,35,36,37,38,43,44,45,46)/p+1/t11-,12-,13+,14+,17?,18?,25?,26?/m1/s1 |
| InChIKey | NZGQEDUTEJPCJQ-WASFTWQNSA-O |
| XLogP | 0.33 |
| TPSA | 279.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.61 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|