C19H27N5O6 — CID 137060417
N-[9-[(2R,3S,5R)-4-hydroxy-5-(hydroxymethyl)-3-pent-4-enoxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide (PubChem CID 137060417) has the molecular formula C19H27N5O6 and a molecular weight of 421.45 g/mol. Its IUPAC name is N-[9-[(2R,3S,5R)-4-hydroxy-5-(hydroxymethyl)-3-pent-4-enoxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(2R,3S,5R)-4-hydroxy-5-(hydroxymethyl)-3-pent-4-enoxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 137060417 |
| Molecular Formula | C19H27N5O6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-[9-[(2R,3S,5R)-4-hydroxy-5-(hydroxymethyl)-3-pent-4-enoxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| SMILES | C=CCCCO[C@H]1C(O)[C@@H](CO)O[C@H]1n1cnc2c(=O)[nH]c(NC(=O)C(C)C)nc21 |
| InChI | InChI=1S/C19H27N5O6/c1-4-5-6-7-29-14-13(26)11(8-25)30-18(14)24-9-20-12-15(24)21-19(23-17(12)28)22-16(27)10(2)3/h4,9-11,13-14,18,25-26H,1,5-8H2,2-3H3,(H2,21,22,23,27,28)/t11-,13?,14+,18-/m1/s1 |
| InChIKey | ZKUJXCMBBIJMPL-UBHSXOEASA-N |
| XLogP | 0.32 |
| TPSA | 151.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|