C37H40N8O7 — CID 155766305
N-[9-[(2R,3R,4S,5S)-4-(2-azidoethyl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide (PubChem CID 155766305) has the molecular formula C37H40N8O7 and a molecular weight of 708.78 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5S)-4-(2-azidoethyl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(2R,3R,4S,5S)-4-(2-azidoethyl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 155766305 |
| Molecular Formula | C37H40N8O7 |
| Molecular Weight | 708.78 g/mol |
| Exact Mass | 708.30 |
| IUPAC Name | N-[9-[(2R,3R,4S,5S)-4-(2-azidoethyl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(NC(=O)C(C)C)nc43)[C@H](O)[C@@H]2CCN=[N+]=[N-])(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H40N8O7/c1-22(2)33(47)42-36-41-32-30(34(48)43-36)39-21-45(32)35-31(46)28(18-19-40-44-38)29(52-35)20-51-37(23-8-6-5-7-9-23,24-10-14-26(49-3)15-11-24)25-12-16-27(50-4)17-13-25/h5-17,21-22,28-29,31,35,46H,18-20H2,1-4H3,(H2,41,42,43,47,48)/t28-,29-,31-,35-/m1/s1 |
| InChIKey | MVTJFQXFSXVXIZ-FHSDPBSVSA-N |
| XLogP | 5.31 |
| TPSA | 198.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.78 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|