C35H35F2N5O7 — CID 137102569
N-[9-[(2R,3S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4,4-difluoro-3-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide (PubChem CID 137102569) has the molecular formula C35H35F2N5O7 and a molecular weight of 675.69 g/mol. Its IUPAC name is N-[9-[(2R,3S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4,4-difluoro-3-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(2R,3S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4,4-difluoro-3-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 137102569 |
| Molecular Formula | C35H35F2N5O7 |
| Molecular Weight | 675.69 g/mol |
| Exact Mass | 675.25 |
| IUPAC Name | N-[9-[(2R,3S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4,4-difluoro-3-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(NC(=O)C(C)C)nc43)[C@H](O)C2(F)F)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H35F2N5O7/c1-20(2)30(44)40-33-39-29-27(31(45)41-33)38-19-42(29)32-28(43)35(36,37)26(49-32)18-48-34(21-8-6-5-7-9-21,22-10-14-24(46-3)15-11-22)23-12-16-25(47-4)17-13-23/h5-17,19-20,26,28,32,43H,18H2,1-4H3,(H2,39,40,41,44,45)/t26-,28+,32-/m1/s1 |
| InChIKey | VREJNYOOUBGAMU-OBNYREETSA-N |
| XLogP | 4.63 |
| TPSA | 149.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|