C36H39N5O6 — CID 144971382
N-[9-[3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxycyclopentyl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide (PubChem CID 144971382) has the molecular formula C36H39N5O6 and a molecular weight of 637.74 g/mol. Its IUPAC name is N-[9-[3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxycyclopentyl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxycyclopentyl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 144971382 |
| Molecular Formula | C36H39N5O6 |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | N-[9-[3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxycyclopentyl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| SMILES | COc1ccc(C(OCC2CC(n3cnc4c(=O)[nH]c(NC(=O)C(C)C)nc43)CC2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H39N5O6/c1-22(2)33(43)39-35-38-32-31(34(44)40-35)37-21-41(32)27-18-23(30(42)19-27)20-47-36(24-8-6-5-7-9-24,25-10-14-28(45-3)15-11-25)26-12-16-29(46-4)17-13-26/h5-17,21-23,27,30,42H,18-20H2,1-4H3,(H2,38,39,40,43,44) |
| InChIKey | LYGYHXXKHHQSIS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|