C35H36N5O8PS — CID 153455335
[(2R,3R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxy-oxo-sulfidophosphanium (PubChem CID 153455335) has the molecular formula C35H36N5O8PS and a molecular weight of 717.74 g/mol. Its IUPAC name is [(2R,3R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxy-oxo-sulfidophosphanium.
| Compound Name | [(2R,3R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxy-oxo-sulfidophosphanium |
|---|---|
| PubChem CID | 153455335 |
| Molecular Formula | C35H36N5O8PS |
| Molecular Weight | 717.74 g/mol |
| Exact Mass | 717.20 |
| IUPAC Name | [(2R,3R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxy-oxo-sulfidophosphanium |
| SMILES | COc1ccc(C(OC[C@@H]2C[C@@H](O[P+](=O)[S-])[C@H](n3cnc4c(=O)[nH]c(NC(=O)C(C)C)nc43)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H36N5O8PS/c1-21(2)31(41)38-34-37-30-29(32(42)39-34)36-20-40(30)33-28(48-49(43)50)18-27(47-33)19-46-35(22-8-6-5-7-9-22,23-10-14-25(44-3)15-11-23)24-12-16-26(45-4)17-13-24/h5-17,20-21,27-28,33H,18-19H2,1-4H3,(H2,37,38,39,41,42)/t27-,28+,33+/m0/s1 |
| InChIKey | WSJWKHMHALMHGG-QSOCVKKASA-N |
| XLogP | 5.62 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.74 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|