C41H41N5O9P+ — CID 146629148
[(2R,3S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxy-oxo-phenoxyphosphanium (PubChem CID 146629148) has the molecular formula C41H41N5O9P+ and a molecular weight of 778.78 g/mol. Its IUPAC name is [(2R,3S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxy-oxo-phenoxyphosphanium.
| Compound Name | [(2R,3S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxy-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 146629148 |
| Molecular Formula | C41H41N5O9P+ |
| Molecular Weight | 778.78 g/mol |
| Exact Mass | 778.26 |
| IUPAC Name | [(2R,3S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxy-oxo-phenoxyphosphanium |
| SMILES | COc1ccc(C(OC[C@@H]2C[C@H](O[P+](=O)Oc3ccccc3)[C@H](n3cnc4c(=O)[nH]c(NC(=O)C(C)C)nc43)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C41H40N5O9P/c1-26(2)37(47)44-40-43-36-35(38(48)45-40)42-25-46(36)39-34(55-56(49)54-32-13-9-6-10-14-32)23-33(53-39)24-52-41(27-11-7-5-8-12-27,28-15-19-30(50-3)20-16-28)29-17-21-31(51-4)22-18-29/h5-22,25-26,33-34,39H,23-24H2,1-4H3,(H-,43,44,45,47,48)/p+1/t33-,34-,39+/m0/s1 |
| InChIKey | HTFOCPHKVDLAHM-XWCRKRNLSA-O |
| XLogP | 7.15 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.78 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|