C36H36F3N5O7 — CID 167279588
N-[9-[(2R,3R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(trifluoromethoxy)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide (PubChem CID 167279588) has the molecular formula C36H36F3N5O7 and a molecular weight of 707.71 g/mol. Its IUPAC name is N-[9-[(2R,3R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(trifluoromethoxy)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(2R,3R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(trifluoromethoxy)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 167279588 |
| Molecular Formula | C36H36F3N5O7 |
| Molecular Weight | 707.71 g/mol |
| Exact Mass | 707.26 |
| IUPAC Name | N-[9-[(2R,3R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(trifluoromethoxy)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| SMILES | COc1ccc(C(OC[C@@H]2C[C@@H](OC(F)(F)F)[C@H](n3cnc4c(=O)[nH]c(NC(=O)C(C)C)nc43)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H36F3N5O7/c1-21(2)31(45)42-34-41-30-29(32(46)43-34)40-20-44(30)33-28(51-36(37,38)39)18-27(50-33)19-49-35(22-8-6-5-7-9-22,23-10-14-25(47-3)15-11-23)24-12-16-26(48-4)17-13-24/h5-17,20-21,27-28,33H,18-19H2,1-4H3,(H2,41,42,43,45,46)/t27-,28+,33+/m0/s1 |
| InChIKey | GUSNOOBLFUHRFL-QSOCVKKASA-N |
| XLogP | 5.93 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.71 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|