C37H39N5O8 — CID 135473076
[(2R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] acetate (PubChem CID 135473076) has the molecular formula C37H39N5O8 and a molecular weight of 681.75 g/mol. Its IUPAC name is [(2R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] acetate.
| Compound Name | [(2R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 135473076 |
| Molecular Formula | C37H39N5O8 |
| Molecular Weight | 681.75 g/mol |
| Exact Mass | 681.28 |
| IUPAC Name | [(2R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] acetate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(NC(=O)C(C)C)nc43)CC2OC(C)=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H39N5O8/c1-22(2)34(44)40-36-39-33-32(35(45)41-36)38-21-42(33)31-19-29(49-23(3)43)30(50-31)20-48-37(24-9-7-6-8-10-24,25-11-15-27(46-4)16-12-25)26-13-17-28(47-5)18-14-26/h6-18,21-22,29-31H,19-20H2,1-5H3,(H2,39,40,41,44,45)/t29?,30-,31-/m1/s1 |
| InChIKey | QULRBMKSQKJCOR-DGRDJXPTSA-N |
| XLogP | 4.96 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.75 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|