C37H42N5O8PSe — CID 135469233
N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[methyl(methylselanyl)phosphoryl]oxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide (PubChem CID 135469233) has the molecular formula C37H42N5O8PSe and a molecular weight of 794.70 g/mol. Its IUPAC name is N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[methyl(methylselanyl)phosphoryl]oxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[methyl(methylselanyl)phosphoryl]oxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 135469233 |
| Molecular Formula | C37H42N5O8PSe |
| Molecular Weight | 794.70 g/mol |
| Exact Mass | 795.19 |
| IUPAC Name | N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[methyl(methylselanyl)phosphoryl]oxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(NC(=O)C(C)C)nc43)C[C@@H]2O[P@](C)(=O)[Se]C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H42N5O8PSe/c1-23(2)34(43)40-36-39-33-32(35(44)41-36)38-22-42(33)31-20-29(50-51(5,45)52-6)30(49-31)21-48-37(24-10-8-7-9-11-24,25-12-16-27(46-3)17-13-25)26-14-18-28(47-4)19-15-26/h7-19,22-23,29-31H,20-21H2,1-6H3,(H2,39,40,41,43,44)/t29-,30+,31+,51-/m0/s1 |
| InChIKey | SUFVQPMSPSTCBE-OVGCUIDXSA-N |
| XLogP | 5.99 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.70 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|