C37H40N4O10P- — CID 135759417
[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[5-methyl-2-(2-methylpropanoylamino)-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-3-yl] hydrogen phosphate (PubChem CID 135759417) has the molecular formula C37H40N4O10P- and a molecular weight of 731.72 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[5-methyl-2-(2-methylpropanoylamino)-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-3-yl] hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[5-methyl-2-(2-methylpropanoylamino)-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-3-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 135759417 |
| Molecular Formula | C37H40N4O10P- |
| Molecular Weight | 731.72 g/mol |
| Exact Mass | 731.25 |
| IUPAC Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[5-methyl-2-(2-methylpropanoylamino)-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-3-yl] hydrogen phosphate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c4c(=O)[nH]c(NC(=O)C(C)C)nc43)C[C@@H]2OP(=O)([O-])O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H41N4O10P/c1-22(2)34(42)39-36-38-33-32(35(43)40-36)23(3)20-41(33)31-19-29(51-52(44,45)46)30(50-31)21-49-37(24-9-7-6-8-10-24,25-11-15-27(47-4)16-12-25)26-13-17-28(48-5)18-14-26/h6-18,20,22,29-31H,19,21H2,1-5H3,(H2,44,45,46)(H2,38,39,40,42,43)/p-1/t29-,30+,31+/m0/s1 |
| InChIKey | YNTMZIJQJYQWLV-OJDZSJEKSA-M |
| XLogP | 4.79 |
| TPSA | 186.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.72 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|