C37H35Cl2N2O10P — CID 11768100
[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (3,4-dichlorophenyl) hydrogen phosphate (PubChem CID 11768100) has the molecular formula C37H35Cl2N2O10P and a molecular weight of 769.57 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (3,4-dichlorophenyl) hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (3,4-dichlorophenyl) hydrogen phosphate |
|---|---|
| PubChem CID | 11768100 |
| Molecular Formula | C37H35Cl2N2O10P |
| Molecular Weight | 769.57 g/mol |
| Exact Mass | 768.14 |
| IUPAC Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (3,4-dichlorophenyl) hydrogen phosphate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2OP(=O)(O)Oc2ccc(Cl)c(Cl)c2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H35Cl2N2O10P/c1-23-21-41(36(43)40-35(23)42)34-20-32(51-52(44,45)50-29-17-18-30(38)31(39)19-29)33(49-34)22-48-37(24-7-5-4-6-8-24,25-9-13-27(46-2)14-10-25)26-11-15-28(47-3)16-12-26/h4-19,21,32-34H,20,22H2,1-3H3,(H,44,45)(H,40,42,43)/t32-,33+,34+/m0/s1 |
| InChIKey | SJFVKTGCKOIRMI-LBFZIJHGSA-N |
| XLogP | 7.03 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.57 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|