C37H34Cl3N2O9PS — CID 10975060
1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[hydroxy-(2,4,6-trichlorophenoxy)phosphinothioyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 10975060) has the molecular formula C37H34Cl3N2O9PS and a molecular weight of 820.08 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[hydroxy-(2,4,6-trichlorophenoxy)phosphinothioyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[hydroxy-(2,4,6-trichlorophenoxy)phosphinothioyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10975060 |
| Molecular Formula | C37H34Cl3N2O9PS |
| Molecular Weight | 820.08 g/mol |
| Exact Mass | 818.08 |
| IUPAC Name | 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[hydroxy-(2,4,6-trichlorophenoxy)phosphinothioyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2OP(O)(=S)Oc2c(Cl)cc(Cl)cc2Cl)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H34Cl3N2O9PS/c1-22-20-42(36(44)41-35(22)43)33-19-31(50-52(45,53)51-34-29(39)17-26(38)18-30(34)40)32(49-33)21-48-37(23-7-5-4-6-8-23,24-9-13-27(46-2)14-10-24)25-11-15-28(47-3)16-12-25/h4-18,20,31-33H,19,21H2,1-3H3,(H,45,53)(H,41,43,44)/t31-,32+,33+,52?/m0/s1 |
| InChIKey | PIRCYDMOIQFTKP-APXSLQGZSA-N |
| XLogP | 7.80 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.08 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|