C39H34Cl2N2O10 — CID 102304763
2-[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxycarbonyl-4,5-dichlorobenzoic acid (PubChem CID 102304763) has the molecular formula C39H34Cl2N2O10 and a molecular weight of 761.61 g/mol. Its IUPAC name is 2-[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxycarbonyl-4,5-dichlorobenzoic acid.
| Compound Name | 2-[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxycarbonyl-4,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 102304763 |
| Molecular Formula | C39H34Cl2N2O10 |
| Molecular Weight | 761.61 g/mol |
| Exact Mass | 760.16 |
| IUPAC Name | 2-[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxycarbonyl-4,5-dichlorobenzoic acid |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2OC(=O)c2cc(Cl)c(Cl)cc2C(=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H34Cl2N2O10/c1-22-20-43(38(48)42-35(22)44)34-19-32(53-37(47)29-18-31(41)30(40)17-28(29)36(45)46)33(52-34)21-51-39(23-7-5-4-6-8-23,24-9-13-26(49-2)14-10-24)25-11-15-27(50-3)16-12-25/h4-18,20,32-34H,19,21H2,1-3H3,(H,45,46)(H,42,44,48)/t32-,33+,34+/m0/s1 |
| InChIKey | LDFVHTHWNLILMS-LBFZIJHGSA-N |
| XLogP | 6.39 |
| TPSA | 155.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.61 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|