C31H32N2O8P+ — CID 14606960
[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-oxophosphanium (PubChem CID 14606960) has the molecular formula C31H32N2O8P+ and a molecular weight of 591.58 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-oxophosphanium.
| Compound Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-oxophosphanium |
|---|---|
| PubChem CID | 14606960 |
| Molecular Formula | C31H32N2O8P+ |
| Molecular Weight | 591.58 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-oxophosphanium |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2O[PH+]=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H31N2O8P/c1-20-18-33(30(35)32-29(20)34)28-17-26(41-42-36)27(40-28)19-39-31(21-7-5-4-6-8-21,22-9-13-24(37-2)14-10-22)23-11-15-25(38-3)16-12-23/h4-16,18,26-28,42H,17,19H2,1-3H3/p+1/t26-,27+,28+/m0/s1 |
| InChIKey | DNFCXUXXLKONTI-UPRLRBBYSA-O |
| XLogP | 4.48 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|