C33H36N2O7S — CID 14756973
1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 14756973) has the molecular formula C33H36N2O7S and a molecular weight of 604.73 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 14756973 |
| Molecular Formula | C33H36N2O7S |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2OCSC)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H36N2O7S/c1-22-19-35(32(37)34-31(22)36)30-18-28(40-21-43-4)29(42-30)20-41-33(23-8-6-5-7-9-23,24-10-14-26(38-2)15-11-24)25-12-16-27(39-3)17-13-25/h5-17,19,28-30H,18,20-21H2,1-4H3,(H,34,36,37)/t28-,29+,30+/m0/s1 |
| InChIKey | GNENCCLFULVXAV-FRXPANAUSA-N |
| XLogP | 4.86 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|