C38H40N3O8P — CID 10818462
1-[(2R,4S,5R)-4-[anilino(methyl)phosphoryl]oxy-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 10818462) has the molecular formula C38H40N3O8P and a molecular weight of 697.73 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[anilino(methyl)phosphoryl]oxy-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[anilino(methyl)phosphoryl]oxy-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10818462 |
| Molecular Formula | C38H40N3O8P |
| Molecular Weight | 697.73 g/mol |
| Exact Mass | 697.26 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[anilino(methyl)phosphoryl]oxy-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2O[P@](C)(=O)Nc2ccccc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H40N3O8P/c1-26-24-41(37(43)39-36(26)42)35-23-33(49-50(4,44)40-30-13-9-6-10-14-30)34(48-35)25-47-38(27-11-7-5-8-12-27,28-15-19-31(45-2)20-16-28)29-17-21-32(46-3)22-18-29/h5-22,24,33-35H,23,25H2,1-4H3,(H,40,44)(H,39,42,43)/t33-,34+,35+,50-/m0/s1 |
| InChIKey | BAIUACGGVBALOO-YUMFIPOQSA-N |
| XLogP | 6.48 |
| TPSA | 130.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.73 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|