C37H37N2O10P — CID 10898094
[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] phenyl hydrogen phosphate (PubChem CID 10898094) has the molecular formula C37H37N2O10P and a molecular weight of 700.68 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] phenyl hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] phenyl hydrogen phosphate |
|---|---|
| PubChem CID | 10898094 |
| Molecular Formula | C37H37N2O10P |
| Molecular Weight | 700.68 g/mol |
| Exact Mass | 700.22 |
| IUPAC Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] phenyl hydrogen phosphate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2OP(=O)(O)Oc2ccccc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H37N2O10P/c1-25-23-39(36(41)38-35(25)40)34-22-32(49-50(42,43)48-31-12-8-5-9-13-31)33(47-34)24-46-37(26-10-6-4-7-11-26,27-14-18-29(44-2)19-15-27)28-16-20-30(45-3)21-17-28/h4-21,23,32-34H,22,24H2,1-3H3,(H,42,43)(H,38,40,41)/t32-,33+,34+/m0/s1 |
| InChIKey | DLKSKNOCPCYSRB-LBFZIJHGSA-N |
| XLogP | 5.72 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.68 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|