C31H33N2O8PS — CID 10484057
methoxy-[(2R,3S,5R)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]sulfanylphosphinic acid (PubChem CID 10484057) has the molecular formula C31H33N2O8PS and a molecular weight of 624.65 g/mol. Its IUPAC name is methoxy-[(2R,3S,5R)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]sulfanylphosphinic acid.
| Compound Name | methoxy-[(2R,3S,5R)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]sulfanylphosphinic acid |
|---|---|
| PubChem CID | 10484057 |
| Molecular Formula | C31H33N2O8PS |
| Molecular Weight | 624.65 g/mol |
| Exact Mass | 624.17 |
| IUPAC Name | methoxy-[(2R,3S,5R)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]sulfanylphosphinic acid |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2SP(=O)(O)OC)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H33N2O8PS/c1-21-19-33(30(35)32-29(21)34)28-18-27(43-42(36,37)39-3)26(41-28)20-40-31(22-10-6-4-7-11-22,23-12-8-5-9-13-23)24-14-16-25(38-2)17-15-24/h4-17,19,26-28H,18,20H2,1-3H3,(H,36,37)(H,32,34,35)/t26-,27+,28-/m1/s1 |
| InChIKey | VOIKJKSQGBOVLV-OZNIXHKMSA-N |
| XLogP | 5.00 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|