C32H34N2O9S — CID 92906881
[(2S,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] methanesulfonate (PubChem CID 92906881) has the molecular formula C32H34N2O9S and a molecular weight of 622.70 g/mol. Its IUPAC name is [(2S,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] methanesulfonate.
| Compound Name | [(2S,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 92906881 |
| Molecular Formula | C32H34N2O9S |
| Molecular Weight | 622.70 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | [(2S,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] methanesulfonate |
| SMILES | COc1ccc(C(OC[C@@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2OS(C)(=O)=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H34N2O9S/c1-21-19-34(31(36)33-30(21)35)29-18-27(43-44(4,37)38)28(42-29)20-41-32(22-8-6-5-7-9-22,23-10-14-25(39-2)15-11-23)24-12-16-26(40-3)17-13-24/h5-17,19,27-29H,18,20H2,1-4H3,(H,33,35,36)/t27-,28-,29+/m0/s1 |
| InChIKey | CSSBLGFIJWFQNH-YTCPBCGMSA-N |
| XLogP | 3.50 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.70 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|