C31H32N2O7PS2+ — CID 14444365
[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-sulfanyl-sulfanylidenephosphanium (PubChem CID 14444365) has the molecular formula C31H32N2O7PS2+ and a molecular weight of 639.71 g/mol. Its IUPAC name is [2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-sulfanyl-sulfanylidenephosphanium.
| Compound Name | [2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-sulfanyl-sulfanylidenephosphanium |
|---|---|
| PubChem CID | 14444365 |
| Molecular Formula | C31H32N2O7PS2+ |
| Molecular Weight | 639.71 g/mol |
| Exact Mass | 639.14 |
| IUPAC Name | [2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-sulfanyl-sulfanylidenephosphanium |
| SMILES | COc1ccc(C(OCC2OC(n3cc(C)c(=O)[nH]c3=O)CC2O[P+](=S)S)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H31N2O7PS2/c1-20-18-33(30(35)32-29(20)34)28-17-26(40-41(42)43)27(39-28)19-38-31(21-7-5-4-6-8-21,22-9-13-24(36-2)14-10-22)23-11-15-25(37-3)16-12-23/h4-16,18,26-28H,17,19H2,1-3H3,(H-,32,34,35,42,43)/p+1 |
| InChIKey | DHPXRHKOGKLVHU-UHFFFAOYSA-O |
| XLogP | 5.25 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.71 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|