C36H42N2O10P+ — CID 177396366
[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-(5-hydroxypentoxy)-oxophosphanium (PubChem CID 177396366) has the molecular formula C36H42N2O10P+ and a molecular weight of 693.71 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-(5-hydroxypentoxy)-oxophosphanium.
| Compound Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-(5-hydroxypentoxy)-oxophosphanium |
|---|---|
| PubChem CID | 177396366 |
| Molecular Formula | C36H42N2O10P+ |
| Molecular Weight | 693.71 g/mol |
| Exact Mass | 693.26 |
| IUPAC Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-(5-hydroxypentoxy)-oxophosphanium |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2O[P+](=O)OCCCCCO)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H41N2O10P/c1-25-23-38(35(41)37-34(25)40)33-22-31(48-49(42)46-21-9-5-8-20-39)32(47-33)24-45-36(26-10-6-4-7-11-26,27-12-16-29(43-2)17-13-27)28-14-18-30(44-3)19-15-28/h4,6-7,10-19,23,31-33,39H,5,8-9,20-22,24H2,1-3H3/p+1/t31-,32+,33+/m0/s1 |
| InChIKey | IVLYTHFZESGXRH-WIHCDAFUSA-O |
| XLogP | 5.38 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.71 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|