C36H42N2O7S2 — CID 102153954
1-[(2R,4S,5R)-4-[[(4-hydroxy-2-methylbutan-2-yl)disulfanyl]methoxy]-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 102153954) has the molecular formula C36H42N2O7S2 and a molecular weight of 678.87 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[[(4-hydroxy-2-methylbutan-2-yl)disulfanyl]methoxy]-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[[(4-hydroxy-2-methylbutan-2-yl)disulfanyl]methoxy]-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102153954 |
| Molecular Formula | C36H42N2O7S2 |
| Molecular Weight | 678.87 g/mol |
| Exact Mass | 678.24 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[[(4-hydroxy-2-methylbutan-2-yl)disulfanyl]methoxy]-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2OCSSC(C)(C)CCO)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H42N2O7S2/c1-25-22-38(34(41)37-33(25)40)32-21-30(43-24-46-47-35(2,3)19-20-39)31(45-32)23-44-36(26-11-7-5-8-12-26,27-13-9-6-10-14-27)28-15-17-29(42-4)18-16-28/h5-18,22,30-32,39H,19-21,23-24H2,1-4H3,(H,37,40,41)/t30-,31+,32+/m0/s1 |
| InChIKey | FFVYOFVCAVVBLS-DCMFLLSESA-N |
| XLogP | 6.03 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.87 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|