C37H38N2O8 — CID 15946697
[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] hex-5-ynoate (PubChem CID 15946697) has the molecular formula C37H38N2O8 and a molecular weight of 638.72 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] hex-5-ynoate.
| Compound Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] hex-5-ynoate |
|---|---|
| PubChem CID | 15946697 |
| Molecular Formula | C37H38N2O8 |
| Molecular Weight | 638.72 g/mol |
| Exact Mass | 638.26 |
| IUPAC Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] hex-5-ynoate |
| SMILES | C#CCCCC(=O)O[C@H]1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C37H38N2O8/c1-5-6-8-13-34(40)47-31-22-33(39-23-25(2)35(41)38-36(39)42)46-32(31)24-45-37(26-11-9-7-10-12-26,27-14-18-29(43-3)19-15-27)28-16-20-30(44-4)21-17-28/h1,7,9-12,14-21,23,31-33H,6,8,13,22,24H2,2-4H3,(H,38,41,42)/t31-,32+,33+/m0/s1 |
| InChIKey | CCGPBGSNWMTMGN-WIHCDAFUSA-N |
| XLogP | 4.87 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.72 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|