C36H42N5O7PS — CID 136741849
9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[hydroxy(methyl)phosphinothioyl]oxyoxolan-2-yl]-2-(2-methylpropylamino)-1H-purin-6-one (PubChem CID 136741849) has the molecular formula C36H42N5O7PS and a molecular weight of 719.80 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[hydroxy(methyl)phosphinothioyl]oxyoxolan-2-yl]-2-(2-methylpropylamino)-1H-purin-6-one.
| Compound Name | 9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[hydroxy(methyl)phosphinothioyl]oxyoxolan-2-yl]-2-(2-methylpropylamino)-1H-purin-6-one |
|---|---|
| PubChem CID | 136741849 |
| Molecular Formula | C36H42N5O7PS |
| Molecular Weight | 719.80 g/mol |
| Exact Mass | 719.25 |
| IUPAC Name | 9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[hydroxy(methyl)phosphinothioyl]oxyoxolan-2-yl]-2-(2-methylpropylamino)-1H-purin-6-one |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(NCC(C)C)nc43)C[C@@H]2OP(C)(O)=S)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H42N5O7PS/c1-23(2)20-37-35-39-33-32(34(42)40-35)38-22-41(33)31-19-29(48-49(5,43)50)30(47-31)21-46-36(24-9-7-6-8-10-24,25-11-15-27(44-3)16-12-25)26-13-17-28(45-4)18-14-26/h6-18,22-23,29-31H,19-21H2,1-5H3,(H,43,50)(H2,37,39,40,42)/t29-,30+,31+,49?/m0/s1 |
| InChIKey | ISEZPNIMBGABRP-DJRCZKTHSA-N |
| XLogP | 5.82 |
| TPSA | 141.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.80 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|