C32H33FN5O7P — CID 136694667
2-amino-9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[fluoro(methyl)phosphoryl]oxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 136694667) has the molecular formula C32H33FN5O7P and a molecular weight of 649.62 g/mol. Its IUPAC name is 2-amino-9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[fluoro(methyl)phosphoryl]oxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[fluoro(methyl)phosphoryl]oxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136694667 |
| Molecular Formula | C32H33FN5O7P |
| Molecular Weight | 649.62 g/mol |
| Exact Mass | 649.21 |
| IUPAC Name | 2-amino-9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[fluoro(methyl)phosphoryl]oxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(N)nc43)C[C@@H]2OP(C)(=O)F)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H33FN5O7P/c1-41-23-13-9-21(10-14-23)32(20-7-5-4-6-8-20,22-11-15-24(42-2)16-12-22)43-18-26-25(45-46(3,33)40)17-27(44-26)38-19-35-28-29(38)36-31(34)37-30(28)39/h4-16,19,25-27H,17-18H2,1-3H3,(H3,34,36,37,39)/t25-,26+,27+,46?/m0/s1 |
| InChIKey | UPRVUIDKYSGRQD-RFNVZJSWSA-N |
| XLogP | 5.19 |
| TPSA | 152.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|