C37H34ClN5O9P- — CID 135610539
[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] (2-chlorophenyl) phosphate (PubChem CID 135610539) has the molecular formula C37H34ClN5O9P- and a molecular weight of 759.13 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] (2-chlorophenyl) phosphate.
| Compound Name | [(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] (2-chlorophenyl) phosphate |
|---|---|
| PubChem CID | 135610539 |
| Molecular Formula | C37H34ClN5O9P- |
| Molecular Weight | 759.13 g/mol |
| Exact Mass | 758.18 |
| IUPAC Name | [(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] (2-chlorophenyl) phosphate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(N)nc43)C[C@@H]2OP(=O)([O-])Oc2ccccc2Cl)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H35ClN5O9P/c1-47-26-16-12-24(13-17-26)37(23-8-4-3-5-9-23,25-14-18-27(48-2)19-15-25)49-21-31-30(52-53(45,46)51-29-11-7-6-10-28(29)38)20-32(50-31)43-22-40-33-34(43)41-36(39)42-35(33)44/h3-19,22,30-32H,20-21H2,1-2H3,(H,45,46)(H3,39,41,42,44)/p-1/t30-,31+,32+/m0/s1 |
| InChIKey | OTOVAPAYRDTUHN-DCMFLLSESA-M |
| XLogP | 5.60 |
| TPSA | 185.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.13 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|