C12H17N5O7P- — CID 135990397
[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate (PubChem CID 135990397) has the molecular formula C12H17N5O7P- and a molecular weight of 374.27 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate.
| Compound Name | [(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate |
|---|---|
| PubChem CID | 135990397 |
| Molecular Formula | C12H17N5O7P- |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate |
| SMILES | COC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)C[C@H]1OP(=O)([O-])OC |
| InChI | InChI=1S/C12H18N5O7P/c1-21-4-7-6(24-25(19,20)22-2)3-8(23-7)17-5-14-9-10(17)15-12(13)16-11(9)18/h5-8H,3-4H2,1-2H3,(H,19,20)(H3,13,15,16,18)/p-1/t6-,7-,8-/m1/s1 |
| InChIKey | KMQRETVNRLNEFD-BWZBUEFSSA-M |
| XLogP | -0.86 |
| TPSA | 166.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|