C13H16FN5O5 — CID 135794693
[5-(2-amino-6-oxo-1H-purin-9-yl)-3-fluorooxolan-2-yl]methyl 2-methoxyacetate (PubChem CID 135794693) has the molecular formula C13H16FN5O5 and a molecular weight of 341.30 g/mol. Its IUPAC name is [5-(2-amino-6-oxo-1H-purin-9-yl)-3-fluorooxolan-2-yl]methyl 2-methoxyacetate.
| Compound Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-3-fluorooxolan-2-yl]methyl 2-methoxyacetate |
|---|---|
| PubChem CID | 135794693 |
| Molecular Formula | C13H16FN5O5 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-3-fluorooxolan-2-yl]methyl 2-methoxyacetate |
| SMILES | COCC(=O)OCC1OC(n2cnc3c(=O)[nH]c(N)nc32)CC1F |
| InChI | InChI=1S/C13H16FN5O5/c1-22-4-9(20)23-3-7-6(14)2-8(24-7)19-5-16-10-11(19)17-13(15)18-12(10)21/h5-8H,2-4H2,1H3,(H3,15,17,18,21) |
| InChIKey | YKCNTUSRENNFFR-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |