C13H17N5O5S — CID 144647875
[(3S)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl 3-sulfanylpropanoate (PubChem CID 144647875) has the molecular formula C13H17N5O5S and a molecular weight of 355.38 g/mol. Its IUPAC name is [(3S)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl 3-sulfanylpropanoate.
| Compound Name | [(3S)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 144647875 |
| Molecular Formula | C13H17N5O5S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | [(3S)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl 3-sulfanylpropanoate |
| SMILES | Nc1nc2c(ncn2C2C[C@H](O)C(COC(=O)CCS)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H17N5O5S/c14-13-16-11-10(12(21)17-13)15-5-18(11)8-3-6(19)7(23-8)4-22-9(20)1-2-24/h5-8,19,24H,1-4H2,(H3,14,16,17,21)/t6-,7?,8?/m0/s1 |
| InChIKey | SWDIWZJBMVNAPV-KKMMWDRVSA-N |
| XLogP | -0.79 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|