C10H31N5O28P6 — CID 161404625
2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;phosphoric acid (PubChem CID 161404625) has the molecular formula C10H31N5O28P6 and a molecular weight of 855.21 g/mol. Its IUPAC name is 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;phosphoric acid.
| Compound Name | 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;phosphoric acid |
|---|---|
| PubChem CID | 161404625 |
| Molecular Formula | C10H31N5O28P6 |
| Molecular Weight | 855.21 g/mol |
| Exact Mass | 854.96 |
| IUPAC Name | 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;phosphoric acid |
| SMILES | Nc1nc2c(ncn2[C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]1.O=P(O)(O)O.O=P(O)(O)O.O=P(O)(O)O.O=P(O)(O)O.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C10H13N5O4.6H3O4P/c11-10-13-8-7(9(18)14-10)12-3-15(8)6-1-4(17)5(2-16)19-6;6*1-5(2,3)4/h3-6,16-17H,1-2H2,(H3,11,13,14,18);6*(H3,1,2,3,4)/t4-,5+,6+;;;;;;/m0....../s1 |
| InChIKey | VURGLLFKKNYBTQ-DYLLDAADSA-N |
| XLogP | -7.23 |
| TPSA | 605.84 Ų |
| H-Bond Donors | 22 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.21 |
| LogP ≤ 5 | -7.23 |
| H-Bond Donors ≤ 5 | 22 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|