C10H14N6O4 — CID 135756377
2-amino-9-[(2R,4S,5R)-4-aminooxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135756377) has the molecular formula C10H14N6O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is 2-amino-9-[(2R,4S,5R)-4-aminooxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,4S,5R)-4-aminooxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135756377 |
| Molecular Formula | C10H14N6O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-amino-9-[(2R,4S,5R)-4-aminooxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | NO[C@H]1C[C@H](n2cnc3c(=O)[nH]c(N)nc32)O[C@@H]1CO |
| InChI | InChI=1S/C10H14N6O4/c11-10-14-8-7(9(18)15-10)13-3-16(8)6-1-4(20-12)5(2-17)19-6/h3-6,17H,1-2,12H2,(H3,11,14,15,18)/t4-,5+,6+/m0/s1 |
| InChIKey | WIBZBEGGPAGQDH-KVQBGUIXSA-N |
| XLogP | -1.76 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|