C10H14N5O4P — CID 137213035
2-amino-9-[(2R,5R)-5-(hydroxymethyl)-4-phosphanyloxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 137213035) has the molecular formula C10H14N5O4P and a molecular weight of 299.23 g/mol. Its IUPAC name is 2-amino-9-[(2R,5R)-5-(hydroxymethyl)-4-phosphanyloxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,5R)-5-(hydroxymethyl)-4-phosphanyloxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137213035 |
| Molecular Formula | C10H14N5O4P |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-amino-9-[(2R,5R)-5-(hydroxymethyl)-4-phosphanyloxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@H]2CC(OP)[C@@H](CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H14N5O4P/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(19-20)5(2-16)18-6/h3-6,16H,1-2,20H2,(H3,11,13,14,17)/t4?,5-,6-/m1/s1 |
| InChIKey | FCNABXPEPRAJEG-YSLANXFLSA-N |
| XLogP | -0.84 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|