C21H27N11O8 — CID 137000288
2-amino-9-[(2R,4S,5S)-4-[2-[(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethylamino]oxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 137000288) has the molecular formula C21H27N11O8 and a molecular weight of 561.52 g/mol. Its IUPAC name is 2-amino-9-[(2R,4S,5S)-4-[2-[(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethylamino]oxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,4S,5S)-4-[2-[(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethylamino]oxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137000288 |
| Molecular Formula | C21H27N11O8 |
| Molecular Weight | 561.52 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 2-amino-9-[(2R,4S,5S)-4-[2-[(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethylamino]oxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CCNO[C@H]3C[C@H](n4cnc5c(=O)[nH]c(N)nc54)O[C@H]3CO)[C@@H](O)[C@@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C21H27N11O8/c22-20-27-15-11(17(36)29-20)24-5-31(15)10-3-8(9(4-33)38-10)40-26-2-1-7-13(34)14(35)19(39-7)32-6-25-12-16(32)28-21(23)30-18(12)37/h5-10,13-14,19,26,33-35H,1-4H2,(H3,22,27,29,36)(H3,23,28,30,37)/t7-,8+,9+,10-,13-,14+,19-/m1/s1 |
| InChIKey | HCHNOBLDMDDLTR-VGBMLQENSA-N |
| XLogP | -3.40 |
| TPSA | 279.59 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.52 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|