C11H15N5O4 — CID 136931549
2-amino-9-[5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 136931549) has the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-amino-9-[5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136931549 |
| Molecular Formula | C11H15N5O4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-amino-9-[5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | COC1CC(n2cnc3c(=O)[nH]c(N)nc32)OC1CO |
| InChI | InChI=1S/C11H15N5O4/c1-19-5-2-7(20-6(5)3-17)16-4-13-8-9(16)14-11(12)15-10(8)18/h4-7,17H,2-3H2,1H3,(H3,12,14,15,18) |
| InChIKey | WXKOSYAYWFJVLC-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |