C26H31N5O4Si — CID 136716474
2-amino-9-[(2R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 136716474) has the molecular formula C26H31N5O4Si and a molecular weight of 505.65 g/mol. Its IUPAC name is 2-amino-9-[(2R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136716474 |
| Molecular Formula | C26H31N5O4Si |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 2-amino-9-[(2R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | CC(C)(C)[Si](O[C@H]1C[C@H](n2cnc3c(=O)[nH]c(N)nc32)O[C@@H]1CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H31N5O4Si/c1-26(2,3)36(17-10-6-4-7-11-17,18-12-8-5-9-13-18)35-19-14-21(34-20(19)15-32)31-16-28-22-23(31)29-25(27)30-24(22)33/h4-13,16,19-21,32H,14-15H2,1-3H3,(H3,27,29,30,33)/t19-,20+,21+/m0/s1 |
| InChIKey | QLWKMPIIYATQGS-PWRODBHTSA-N |
| XLogP | 1.93 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|