C46H41N5O4Si2 — CID 136717456
2-amino-9-[(2R,4S,5R)-4-triphenylsilyloxy-5-(triphenylsilyloxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 136717456) has the molecular formula C46H41N5O4Si2 and a molecular weight of 784.04 g/mol. Its IUPAC name is 2-amino-9-[(2R,4S,5R)-4-triphenylsilyloxy-5-(triphenylsilyloxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,4S,5R)-4-triphenylsilyloxy-5-(triphenylsilyloxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136717456 |
| Molecular Formula | C46H41N5O4Si2 |
| Molecular Weight | 784.04 g/mol |
| Exact Mass | 783.27 |
| IUPAC Name | 2-amino-9-[(2R,4S,5R)-4-triphenylsilyloxy-5-(triphenylsilyloxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@H]2C[C@H](O[Si](c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H](CO[Si](c3ccccc3)(c3ccccc3)c3ccccc3)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C46H41N5O4Si2/c47-46-49-44-43(45(52)50-46)48-33-51(44)42-31-40(55-57(37-25-13-4-14-26-37,38-27-15-5-16-28-38)39-29-17-6-18-30-39)41(54-42)32-53-56(34-19-7-1-8-20-34,35-21-9-2-10-22-35)36-23-11-3-12-24-36/h1-30,33,40-42H,31-32H2,(H3,47,49,50,52)/t40-,41+,42+/m0/s1 |
| InChIKey | VXSGEEGIBQYDFG-FEWNNGCESA-N |
| XLogP | 3.73 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.04 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|