C42H49N5O4Si2 — CID 136914028
2-amino-9-[(2R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]-1H-purin-6-one (PubChem CID 136914028) has the molecular formula C42H49N5O4Si2 and a molecular weight of 744.06 g/mol. Its IUPAC name is 2-amino-9-[(2R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136914028 |
| Molecular Formula | C42H49N5O4Si2 |
| Molecular Weight | 744.06 g/mol |
| Exact Mass | 743.33 |
| IUPAC Name | 2-amino-9-[(2R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]-1H-purin-6-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H49N5O4Si2/c1-41(2,3)52(30-19-11-7-12-20-30,31-21-13-8-14-22-31)49-28-35-34(27-36(50-35)47-29-44-37-38(47)45-40(43)46-39(37)48)51-53(42(4,5)6,32-23-15-9-16-24-32)33-25-17-10-18-26-33/h7-26,29,34-36H,27-28H2,1-6H3,(H3,43,45,46,48)/t34-,35+,36+/m0/s1 |
| InChIKey | ZCJIFYYGWVEVMR-LIVOIKKVSA-N |
| XLogP | 5.51 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.06 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|