C30H35N5O4Si — CID 139714506
[(2R,3S,5R)-5-(2-amino-6-ethenylpurin-9-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] acetate (PubChem CID 139714506) has the molecular formula C30H35N5O4Si and a molecular weight of 557.73 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(2-amino-6-ethenylpurin-9-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-5-(2-amino-6-ethenylpurin-9-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 139714506 |
| Molecular Formula | C30H35N5O4Si |
| Molecular Weight | 557.73 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | [(2R,3S,5R)-5-(2-amino-6-ethenylpurin-9-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] acetate |
| SMILES | C=Cc1nc(N)nc2c1ncn2[C@H]1C[C@H](OC(C)=O)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C30H35N5O4Si/c1-6-23-27-28(34-29(31)33-23)35(19-32-27)26-17-24(38-20(2)36)25(39-26)18-37-40(30(3,4)5,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h6-16,19,24-26H,1,17-18H2,2-5H3,(H2,31,33,34)/t24-,25+,26+/m0/s1 |
| InChIKey | TWSDQEODKUAQFN-JIMJEQGWSA-N |
| XLogP | 3.85 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.73 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|