C33H43N5O4Si2 — CID 139714504
[(2R,3S,5R)-5-[2-amino-6-(2-trimethylsilylethenyl)purin-9-yl]-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] acetate (PubChem CID 139714504) has the molecular formula C33H43N5O4Si2 and a molecular weight of 629.91 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[2-amino-6-(2-trimethylsilylethenyl)purin-9-yl]-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-5-[2-amino-6-(2-trimethylsilylethenyl)purin-9-yl]-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 139714504 |
| Molecular Formula | C33H43N5O4Si2 |
| Molecular Weight | 629.91 g/mol |
| Exact Mass | 629.29 |
| IUPAC Name | [(2R,3S,5R)-5-[2-amino-6-(2-trimethylsilylethenyl)purin-9-yl]-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](n2cnc3c(C=C[Si](C)(C)C)nc(N)nc32)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H43N5O4Si2/c1-23(39)41-27-20-29(38-22-35-30-26(18-19-43(5,6)7)36-32(34)37-31(30)38)42-28(27)21-40-44(33(2,3)4,24-14-10-8-11-15-24)25-16-12-9-13-17-25/h8-19,22,27-29H,20-21H2,1-7H3,(H2,34,36,37)/t27-,28+,29+/m0/s1 |
| InChIKey | KSCYUGTVWSTJHL-ZGIBFIJWSA-N |
| XLogP | 5.09 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.91 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|