C17H25N5O3S2 — CID 159170928
[(2R,3S)-5-[2-amino-6-(butan-2-yldisulfanyl)purin-9-yl]-2-ethyloxolan-3-yl] acetate (PubChem CID 159170928) has the molecular formula C17H25N5O3S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is [(2R,3S)-5-[2-amino-6-(butan-2-yldisulfanyl)purin-9-yl]-2-ethyloxolan-3-yl] acetate.
| Compound Name | [(2R,3S)-5-[2-amino-6-(butan-2-yldisulfanyl)purin-9-yl]-2-ethyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 159170928 |
| Molecular Formula | C17H25N5O3S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | [(2R,3S)-5-[2-amino-6-(butan-2-yldisulfanyl)purin-9-yl]-2-ethyloxolan-3-yl] acetate |
| SMILES | CCC(C)SSc1nc(N)nc2c1ncn2C1C[C@H](OC(C)=O)[C@@H](CC)O1 |
| InChI | InChI=1S/C17H25N5O3S2/c1-5-9(3)26-27-16-14-15(20-17(18)21-16)22(8-19-14)13-7-12(24-10(4)23)11(6-2)25-13/h8-9,11-13H,5-7H2,1-4H3,(H2,18,20,21)/t9?,11-,12+,13?/m1/s1 |
| InChIKey | RDFLKHRHFJNBNZ-JPLDKTBPSA-N |
| XLogP | 3.58 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|