C13H14Cl2N4O3 — CID 88858312
[(2R,3R)-5-(2,6-dichloropurin-9-yl)-2-ethyloxolan-3-yl] acetate (PubChem CID 88858312) has the molecular formula C13H14Cl2N4O3 and a molecular weight of 345.19 g/mol. Its IUPAC name is [(2R,3R)-5-(2,6-dichloropurin-9-yl)-2-ethyloxolan-3-yl] acetate.
| Compound Name | [(2R,3R)-5-(2,6-dichloropurin-9-yl)-2-ethyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 88858312 |
| Molecular Formula | C13H14Cl2N4O3 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | [(2R,3R)-5-(2,6-dichloropurin-9-yl)-2-ethyloxolan-3-yl] acetate |
| SMILES | CC[C@H]1OC(n2cnc3c(Cl)nc(Cl)nc32)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C13H14Cl2N4O3/c1-3-7-8(21-6(2)20)4-9(22-7)19-5-16-10-11(14)17-13(15)18-12(10)19/h5,7-9H,3-4H2,1-2H3/t7-,8-,9?/m1/s1 |
| InChIKey | MZYGZTJTOUNPOG-ZAZKALAHSA-N |
| XLogP | 2.76 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |