C19H20Cl2N4O9 — CID 124925217
2-[(2S,3S,4R,5R,6S)-3,5-diacetyloxy-2-(acetyloxymethyl)-6-(2,6-dichloropurin-9-yl)oxan-4-yl]acetic acid (PubChem CID 124925217) has the molecular formula C19H20Cl2N4O9 and a molecular weight of 519.29 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R,6S)-3,5-diacetyloxy-2-(acetyloxymethyl)-6-(2,6-dichloropurin-9-yl)oxan-4-yl]acetic acid.
| Compound Name | 2-[(2S,3S,4R,5R,6S)-3,5-diacetyloxy-2-(acetyloxymethyl)-6-(2,6-dichloropurin-9-yl)oxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 124925217 |
| Molecular Formula | C19H20Cl2N4O9 |
| Molecular Weight | 519.29 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | 2-[(2S,3S,4R,5R,6S)-3,5-diacetyloxy-2-(acetyloxymethyl)-6-(2,6-dichloropurin-9-yl)oxan-4-yl]acetic acid |
| SMILES | CC(=O)OC[C@@H]1O[C@H](n2cnc3c(Cl)nc(Cl)nc32)[C@H](OC(C)=O)[C@H](CC(=O)O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H20Cl2N4O9/c1-7(26)31-5-11-14(32-8(2)27)10(4-12(29)30)15(33-9(3)28)18(34-11)25-6-22-13-16(20)23-19(21)24-17(13)25/h6,10-11,14-15,18H,4-5H2,1-3H3,(H,29,30)/t10-,11+,14+,15-,18+/m1/s1 |
| InChIKey | HCKQJFWLFVOWGG-RARHYVCSSA-N |
| XLogP | 1.55 |
| TPSA | 169.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|