C17H17Cl2N3O7 — CID 71752665
[(2S,3S,4S,5S)-3,4-diacetyloxy-5-(4,6-dichloroimidazo[4,5-c]pyridin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 71752665) has the molecular formula C17H17Cl2N3O7 and a molecular weight of 446.24 g/mol. Its IUPAC name is [(2S,3S,4S,5S)-3,4-diacetyloxy-5-(4,6-dichloroimidazo[4,5-c]pyridin-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5S)-3,4-diacetyloxy-5-(4,6-dichloroimidazo[4,5-c]pyridin-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71752665 |
| Molecular Formula | C17H17Cl2N3O7 |
| Molecular Weight | 446.24 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | [(2S,3S,4S,5S)-3,4-diacetyloxy-5-(4,6-dichloroimidazo[4,5-c]pyridin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](n2cnc3c(Cl)nc(Cl)cc32)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H17Cl2N3O7/c1-7(23)26-5-11-14(27-8(2)24)15(28-9(3)25)17(29-11)22-6-20-13-10(22)4-12(18)21-16(13)19/h4,6,11,14-15,17H,5H2,1-3H3/t11-,14-,15-,17-/m0/s1 |
| InChIKey | QUGRSJQZWTYDHN-SIUGBPQLSA-N |
| XLogP | 2.06 |
| TPSA | 118.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|