C17H19N3O8 — CID 54004809
[(2R,3R,4S,5R)-3,4-diacetyloxy-5-(4-oxo-5H-imidazo[4,5-c]pyridin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 54004809) has the molecular formula C17H19N3O8 and a molecular weight of 393.35 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4-diacetyloxy-5-(4-oxo-5H-imidazo[4,5-c]pyridin-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4-diacetyloxy-5-(4-oxo-5H-imidazo[4,5-c]pyridin-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 54004809 |
| Molecular Formula | C17H19N3O8 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4-diacetyloxy-5-(4-oxo-5H-imidazo[4,5-c]pyridin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]ccc32)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H19N3O8/c1-8(21)25-6-12-14(26-9(2)22)15(27-10(3)23)17(28-12)20-7-19-13-11(20)4-5-18-16(13)24/h4-5,7,12,14-15,17H,6H2,1-3H3,(H,18,24)/t12-,14-,15+,17-/m1/s1 |
| InChIKey | KOCMWVXJLORTTC-JJAZEVLHSA-N |
| XLogP | 0.05 |
| TPSA | 138.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|