C11H13Cl2N4O6P — CID 130458205
[(2R,3R,5R)-5-(2,6-dichloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl methyl hydrogen phosphate (PubChem CID 130458205) has the molecular formula C11H13Cl2N4O6P and a molecular weight of 399.13 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(2,6-dichloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl methyl hydrogen phosphate.
| Compound Name | [(2R,3R,5R)-5-(2,6-dichloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl methyl hydrogen phosphate |
|---|---|
| PubChem CID | 130458205 |
| Molecular Formula | C11H13Cl2N4O6P |
| Molecular Weight | 399.13 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | [(2R,3R,5R)-5-(2,6-dichloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(Cl)nc(Cl)nc32)C[C@H]1O |
| InChI | InChI=1S/C11H13Cl2N4O6P/c1-21-24(19,20)22-3-6-5(18)2-7(23-6)17-4-14-8-9(12)15-11(13)16-10(8)17/h4-7,18H,2-3H2,1H3,(H,19,20)/t5-,6-,7-/m1/s1 |
| InChIKey | XOPLSVNIYKFHDJ-FSDSQADBSA-N |
| XLogP | 1.54 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.13 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|