C10H14ClN6O6P — CID 169436551
amino [(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 169436551) has the molecular formula C10H14ClN6O6P and a molecular weight of 380.69 g/mol. Its IUPAC name is amino [(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | amino [(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 169436551 |
| Molecular Formula | C10H14ClN6O6P |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | amino [(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | NOP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)nc(Cl)nc32)C[C@@H]1O |
| InChI | InChI=1S/C10H14ClN6O6P/c11-10-15-8(12)7-9(16-10)17(3-14-7)6-1-4(18)5(22-6)2-21-24(19,20)23-13/h3-6,18H,1-2,13H2,(H,19,20)(H2,12,15,16)/t4-,5+,6+/m0/s1 |
| InChIKey | WWQBXJLHVHKTDW-KVQBGUIXSA-N |
| XLogP | -0.28 |
| TPSA | 180.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|