C11H14N5O8P — CID 22837841
6-amino-9-[(2R,4S,5R)-4-hydroxy-5-(phosphonooxymethyl)oxolan-2-yl]purine-2-carboxylic acid (PubChem CID 22837841) has the molecular formula C11H14N5O8P and a molecular weight of 375.23 g/mol. Its IUPAC name is 6-amino-9-[(2R,4S,5R)-4-hydroxy-5-(phosphonooxymethyl)oxolan-2-yl]purine-2-carboxylic acid.
| Compound Name | 6-amino-9-[(2R,4S,5R)-4-hydroxy-5-(phosphonooxymethyl)oxolan-2-yl]purine-2-carboxylic acid |
|---|---|
| PubChem CID | 22837841 |
| Molecular Formula | C11H14N5O8P |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 6-amino-9-[(2R,4S,5R)-4-hydroxy-5-(phosphonooxymethyl)oxolan-2-yl]purine-2-carboxylic acid |
| SMILES | Nc1nc(C(=O)O)nc2c1ncn2[C@H]1C[C@H](O)[C@@H](COP(=O)(O)O)O1 |
| InChI | InChI=1S/C11H14N5O8P/c12-8-7-10(15-9(14-8)11(18)19)16(3-13-7)6-1-4(17)5(24-6)2-23-25(20,21)22/h3-6,17H,1-2H2,(H,18,19)(H2,12,14,15)(H2,20,21,22)/t4-,5+,6+/m0/s1 |
| InChIKey | ZQKGPGXGQTXLDQ-KVQBGUIXSA-N |
| XLogP | -1.14 |
| TPSA | 203.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|