C10H12ClN5O3S — CID 123536828
5-(6-amino-2-chloropurin-9-yl)-2-(sulfanyloxymethyl)oxolan-3-ol (PubChem CID 123536828) has the molecular formula C10H12ClN5O3S and a molecular weight of 317.76 g/mol. Its IUPAC name is 5-(6-amino-2-chloropurin-9-yl)-2-(sulfanyloxymethyl)oxolan-3-ol.
| Compound Name | 5-(6-amino-2-chloropurin-9-yl)-2-(sulfanyloxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 123536828 |
| Molecular Formula | C10H12ClN5O3S |
| Molecular Weight | 317.76 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 5-(6-amino-2-chloropurin-9-yl)-2-(sulfanyloxymethyl)oxolan-3-ol |
| SMILES | Nc1nc(Cl)nc2c1ncn2C1CC(O)C(COS)O1 |
| InChI | InChI=1S/C10H12ClN5O3S/c11-10-14-8(12)7-9(15-10)16(3-13-7)6-1-4(17)5(19-6)2-18-20/h3-6,17,20H,1-2H2,(H2,12,14,15) |
| InChIKey | YYGCJIHNEBIMMV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.76 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|