C13H14ClN5O7 — CID 134326776
2-[[(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy]propanedioic acid (PubChem CID 134326776) has the molecular formula C13H14ClN5O7 and a molecular weight of 387.74 g/mol. Its IUPAC name is 2-[[(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy]propanedioic acid.
| Compound Name | 2-[[(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy]propanedioic acid |
|---|---|
| PubChem CID | 134326776 |
| Molecular Formula | C13H14ClN5O7 |
| Molecular Weight | 387.74 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 2-[[(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy]propanedioic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@H]1C[C@H](O)[C@@H](COC(C(=O)O)C(=O)O)O1 |
| InChI | InChI=1S/C13H14ClN5O7/c14-13-17-9(15)7-10(18-13)19(3-16-7)6-1-4(20)5(26-6)2-25-8(11(21)22)12(23)24/h3-6,8,20H,1-2H2,(H,21,22)(H,23,24)(H2,15,17,18)/t4-,5+,6+/m0/s1 |
| InChIKey | SQHKKWMWYSGJNF-KVQBGUIXSA-N |
| XLogP | -0.74 |
| TPSA | 182.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.74 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|